Compound Q&A

What precautions should be taken when handling {4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}acetic acid dihydrochloride (CAS: 1000690-91-4)?

Answer

{4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}acetic acid dihydrochloride
When handling {4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}acetic acid dihydrochloride, appropriate personal protective equipment (PPE) is essential, including gloves, goggles, and laboratory coats. It should be used in a fume hood due to its volatility and potential for inhalation hazards. In case of a spill, it is recommended to use appropriate absorbent materials and ensure proper containment and disposal according to the Material Safety Data Sheet (MSDS/SDS).

About

English Name {4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}acetic acid dihydrochloride
Molecular Formula C19H23Cl3N2O2
Molecular Weight 417.76 g/mol
SMILES c1ccc(cc1)C(c2ccc(cc2)Cl)N3CCN(CC3)CC(=O)O.Cl.Cl
InChIKey LSPZEDLYSAUAQV-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of {4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}acetic acid dihydrochloride (CAS: 1000690-91-4)?

The physical properties of {4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}acetic acid dihydrochlo...

Compound Q&A

How is {4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}acetic acid dihydrochloride (CAS: 1000690-91-4) typically synthesized?

This compound is typically synthesized through multistep organic synthesis. It involves the condensa...

Compound Q&A

What industries use {4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}acetic acid dihydrochloride (CAS: 1000690-91-4)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug candidate...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...