Compound Q&A

How should (e)-n-(2-(3,4-dihydroxyphenyl)ethyl)-3-(4-hydroxyphenyl)-2-propenamide (CAS: 103188-46-1) be stored?

Answer

(e)-n-(2-(3,4-dihydroxyphenyl)ethyl)-3-(4-hydroxyphenyl)-2-propenaMide
This compound should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation. Avoid contact with incompatible materials and ensure good ventilation during storage to prevent any adverse reactions.

About

English Name (e)-n-(2-(3,4-dihydroxyphenyl)ethyl)-3-(4-hydroxyphenyl)-2-propenaMide
Molecular Formula C17H17NO4
Molecular Weight 299.3212 g/mol
SMILES O=C(/C=C/c1ccc(cc1)O)NCCc1ccc(c(c1)O)O
InChIKey KZUJJPCTENPKOE-XBXARRHUSA-N
Last Updated: 2025-12-31 02:27

Related Q&A

Compound Q&A

What is (e)-n-(2-(3,4-dihydroxyphenyl)ethyl)-3-(4-hydroxyphenyl)-2-propenamide (CAS: 103188-46-1)?

(e)-n-(2-(3,4-dihydroxyphenyl)ethyl)-3-(4-hydroxyphenyl)-2-propenamide, also known as 2-(3,4-dihydro...

Compound Q&A

What are the main uses of (e)-n-(2-(3,4-dihydroxyphenyl)ethyl)-3-(4-hydroxyphenyl)-2-propenamide (CAS: 103188-46-1)?

This compound is primarily used in pharmaceutical applications for its potential as an anti-inflamma...

Compound Q&A

Is (e)-n-(2-(3,4-dihydroxyphenyl)ethyl)-3-(4-hydroxyphenyl)-2-propenamide (CAS: 103188-46-1) safe?

This compound is generally considered safe under normal use. However, it is important to handle it w...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...