Compound Q&A

How should (4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole) (CAS: 1373357-00-6) be stored?

Answer

(4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole)
(4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole) should be stored in a cool, dry place away from direct sunlight and heat sources. It is advisable to keep it in a tightly sealed container to prevent moisture absorption. Avoid exposure to high humidity and maintain a temperature range of 15-25°C for optimal storage conditions.

About

English Name (4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole)
Molecular Formula C18H30N2O2
Molecular Weight 306.45 g/mol
SMILES CC(C)[C@H]1COC(=N1)C1(CCCCC1)C1=N[C@H](CO1)C(C)C
InChIKey KRZPFTLDCGJNJC-HUUCEWRRSA-N
Last Updated: 2025-12-30 09:27

Related Q&A

Compound Q&A

What is (4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole) (CAS: 1373357-00-6)?

(4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole) is a cyclic compound wit...

Compound Q&A

What are the main uses of (4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole) (CAS: 1373357-00-6)?

(4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole) is primarily used in pha...

Compound Q&A

Is (4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole) (CAS: 1373357-00-6) safe?

(4S,4'S)-2,2'-(1,1-Cyclohexanediyl)bis(4-isopropyl-4,5-dihydro-1,3-oxazole) is generally safe when h...

Compound Q&A

What are the main uses of (5-Sulfamoyl-3-pyridinyl)boronic acid (CAS: 951233-61-7)?

(5-Sulfamoyl-3-pyridinyl)boronic acid is primarily used in chemical synthesis, p...

951233-61-7(5-Sulfamoyl-3-pyrid...
Compound Q&A

How is Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate (CAS: 1942858-50-5) typically synthesized?

Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate is typically synthesized via est...

1942858-50-5Benzyl 2-methyl-2-(m...
Compound Q&A

What precautions should be taken when handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

When handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0), it is important to use p...

209353-22-08-Fluoroquinolin-6-o...
Compound Q&A

What are the physical and chemical properties of 1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2)?

1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2) is a crystalline c...

129316-09-21,3-Dibromo-5-(2-met...