Compound Q&A

What are the physical and chemical properties of Prolactin Releasing Peptide (1-31), human (CAS: 215510-22-8)?

Answer

Prolactin Releasing Peptide (1-31), human
Prolactin Releasing Peptide (1-31), human is a crystalline protein with a molecular weight of approximately 3,500 Da. It is highly soluble in water and has a low reactivity under normal conditions. This compound exhibits stability in aqueous solutions but should be protected from strong acids and bases.

About

English Name Prolactin Releasing Peptide (1-31), human
Molecular Formula C104H158N32O26
Molecular Weight 2272.56614160538 g/mol
SMILES O=C([C@H](CCCNC(=N)N)NC([C@H]([C@@H](C)CC)NC(CNC([C@H](CCCNC(=N)N)NC([C@H](CO)NC([C@H](C)NC([C@H](CC1C=CC(=CC=1)O)NC([C@H](CC1=CNC2C=CC=CC1=2)NC([C@H](C)NC([C@@H]1CCCN1C([C@H](CC(N)=O)NC([C@H]([C@@H](C)CC)NC([C@H](CC(=O)O)NC([C@@H]1CCCN1C([C@H]([C@@H](C)O)N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)N1CCC[C@H]1C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(N)=O)CC1C=CC=CC=1)=O)CCCNC(=N)N)=O)=O)C(C)C)=O
InChIKey CPYRNXJVNKJULS-FWGIIJIJSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is Prolactin Releasing Peptide (1-31), human (CAS: 215510-22-8) typically synthesized?

Prolactin Releasing Peptide (1-31), human is synthesized through solid-phase peptide synthesis. Comm...

Compound Q&A

What industries use Prolactin Releasing Peptide (1-31), human (CAS: 215510-22-8)?

Prolactin Releasing Peptide (1-31), human is primarily used in the pharmaceutical industry for resea...

Compound Q&A

What precautions should be taken when handling Prolactin Releasing Peptide (1-31), human (CAS: 215510-22-8)?

When handling Prolactin Releasing Peptide (1-31), human, use appropriate personal protective equipme...

Compound Q&A

What are the main uses of 5-Bromo-2-(methylamino)benzamide (CAS: 22721-18-2)?

5-Bromo-2-(methylamino)benzamide is primarily used in pharmaceutical research as...

22721-18-25-Bromo-2-(methylami...
Compound Q&A

What are the main uses of 2,4-Dicarboxypyridine 1-oxide (CAS: 16830-32-3)?

2,4-Dicarboxypyridine 1-oxide is primarily used in pharmaceuticals for the synth...

16830-32-32,4-Dicarboxypyridin...
Compound Q&A

Is 1-Bromo-2-pentyne (CAS: 16400-32-1) safe?

1-Bromo-2-pentyne should be handled with caution due to its reactivity and poten...

16400-32-11-Bromo-2-pentyne
Compound Q&A

How should 10-Methyl-3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10H-phenothiazine (CAS: 1579943-34-2) be stored?

10-Methyl-3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10H-phenothiazine...

1579943-34-210-Methyl-3,7-bis(4,...