Compound Q&A

What industries use Ethyl 2-((4-cyanophenyl)amino)acetate (CAS: 218168-58-2)?

Answer

Ethyl 2-((4-cyanophenyl)amino)acetate
Ethyl 2-((4-cyanophenyl)amino)acetate (CAS: 218168-58-2) is used in the pharmaceutical industry for the synthesis of certain derivatives and intermediates. It is also utilized in the polymer industry for the development of functional polymers. Additionally, it has applications in the semiconductor industry for thin film production and in the sensor industry as a functional material.

About

English Name Ethyl 2-((4-cyanophenyl)amino)acetate
Molecular Formula C11H12N2O2
Molecular Weight 204.2252 g/mol
SMILES CCOC(=O)CNC1=CC=C(C=C1)C#N
InChIKey RFCHXXFHULMCDW-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-((4-cyanophenyl)amino)acetate (CAS: 218168-58-2)?

Ethyl 2-((4-cyanophenyl)amino)acetate (CAS: 218168-58-2) is a crystalline solid with a molecular wei...

Compound Q&A

How is Ethyl 2-((4-cyanophenyl)amino)acetate (CAS: 218168-58-2) typically synthesized?

Ethyl 2-((4-cyanophenyl)amino)acetate (CAS: 218168-58-2) is typically synthesized by the reaction of...

Compound Q&A

What precautions should be taken when handling Ethyl 2-((4-cyanophenyl)amino)acetate (CAS: 218168-58-2)?

When handling Ethyl 2-((4-cyanophenyl)amino)acetate (CAS: 218168-58-2), it is essential to wear appr...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...