Compound Q&A

What are the physical and chemical properties of Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate (CAS: 518047-98-8)?

Answer

Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate
Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate (CAS: 518047-98-8) is a white crystalline solid with a molecular weight of approximately 321.36 g/mol. It has a low solubility in water but is more soluble in organic solvents. This compound is known for its reactivity in forming amide bonds and its use in various synthetic applications. It is relatively stable under normal conditions but should be stored in a dry environment to prevent hydrolysis.

About

English Name Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate
Molecular Formula C12H17N3O3
Molecular Weight 251.286 g/mol
SMILES CC(C)(C(=NO)N)NC(=O)OCC1=CC=CC=C1
InChIKey WWSJZCLRWHEHPA-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate (CAS: 518047-98-8) typically synthesized?

Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate (CAS: 518047-98-8) is typically synth...

Compound Q&A

What industries use Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate (CAS: 518047-98-8)?

Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate (CAS: 518047-98-8) is primarily used ...

Compound Q&A

What precautions should be taken when handling Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate (CAS: 518047-98-8)?

When handling Benzyl [1-(hydroxyamino)-1-imino-2-methyl-2-propanyl]carbamate (CAS: 518047-98-8), it ...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...