Compound Q&A

How is 1,1'-Oxybis[4-(methoxymethyl)benzene] (CAS: 2509-26-4) typically synthesized?

Answer

1,1'-Oxybis[4-(methoxymethyl)benzene]
1,1'-Oxybis[4-(methoxymethyl)benzene] is synthesized by the reaction of 4-hydroxybenzaldehyde with methanol in the presence of a suitable catalyst like anhydrous aluminum chloride. The reaction involves the methylation of the hydroxyl group followed by intramolecular cyclization using an oxygen bridge. The yield is moderate to good, and the selectivity is high.

About

CAS No 2509-26-4
English Name 1,1'-Oxybis[4-(methoxymethyl)benzene]
Molecular Formula C16H18O3
Molecular Weight 258.31699999999995 g/mol
SMILES COCC1=CC=C(C=C1)OC2=CC=C(C=C2)COC
InChIKey BMWBYLGWPWDACF-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1'-Oxybis[4-(methoxymethyl)benzene] (CAS: 2509-26-4)?

1,1'-Oxybis[4-(methoxymethyl)benzene] is a colorless solid with a melting point of 125-126°C. Its mo...

Compound Q&A

What industries use 1,1'-Oxybis[4-(methoxymethyl)benzene] (CAS: 2509-26-4)?

1,1'-Oxybis[4-(methoxymethyl)benzene] is used in various industries. In pharmaceuticals, it serves a...

Compound Q&A

What precautions should be taken when handling 1,1'-Oxybis[4-(methoxymethyl)benzene] (CAS: 2509-26-4)?

When handling 1,1'-Oxybis[4-(methoxymethyl)benzene], appropriate personal protective equipment (PPE)...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...