Compound Q&A

What regulatory guidelines apply to 6-Amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid (CAS: 858956-08-8)?

Answer

6-Amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid
6-Amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid (CAS: 858956-08-8) is subject to the GHS classification system which categorizes it as a hazardous substance. In the EU, it falls under the REACH regulations, requiring registration and evaluation. Additionally, the FDA and EPA may have specific requirements for handling, storage, and disposal in the United States, particularly for industrial applications or research purposes.

About

English Name 6-Amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid
Molecular Formula C8H8ClN3O2
Molecular Weight 213.624 g/mol
SMILES C1CC1c2nc(c(c(n2)N)Cl)C(=O)O
InChIKey KWAIHLIXESXTJL-UHFFFAOYSA-N
Last Updated: 2025-11-08 12:31

Related Q&A

Compound Q&A

Are there alternatives to 6-Amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid (CAS: 858956-08-8) in synthesis?

Alternative reagents such as 6-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid or other amino deriv...

Compound Q&A

What is the market or research trend for 6-Amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid (CAS: 858956-08-8)?

The market for 6-Amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid (CAS: 858956-08-8) is driv...

Compound Q&A

How should waste containing 6-Amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid (CAS: 858956-08-8) be handled?

Waste containing 6-Amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid (CAS: 858956-08-8) shoul...

Compound Q&A

Is 2-(2-chloroacetamido)-3-phenylpropanoic acid (CAS: 7765-11-9) safe?

2-(2-Chloroacetamido)-3-phenylpropanoic acid (CAS: 7765-11-9) is generally consi...

7765-11-92-(2-chloroacetamido...
Compound Q&A

Is 2-(Benzyloxy)-5-bromobenzoic acid (CAS: 62176-31-2) safe?

2-(Benzyloxy)-5-bromobenzoic acid can be handled safely if appropriate precautio...

62176-31-22-(Benzyloxy)-5-brom...
Compound Q&A

What is (4-Methyl-1,2,5-oxadiazol-3-yl)methanamine hydrochloride (CAS: 1159825-48-5)?

(4-Methyl-1,2,5-oxadiazol-3-yl)methanamine hydrochloride is a chemical compound ...

1159825-48-5(4-Methyl-1,2,5-oxad...
Compound Q&A

What is 2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 917985-54-7)?

2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 917985-54...

917985-54-72-(5-Hexylthiophen-2...