Compound Q&A

How is Delta-7-Avenasterol (CAS: 23290-26-8) typically synthesized?

Answer

Delta-7-Avenasterol
Delta-7-Avenasterol is typically synthesized from sitosterol using enzymatic or chemical reduction methods. The reaction involves the reduction of the double bond at position 7, and can be catalyzed by enzymes or chemical reagents such as borohydride. The yield and selectivity are influenced by the reaction conditions and catalysts used.

About

CAS No 23290-26-8
English Name Delta-7-Avenasterol
Molecular Formula C29H48O
Molecular Weight 412.7020000000002 g/mol
SMILES CC=C(CCC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4)O)C)C)C(C)C
InChIKey MCWVPSBQQXUCTB-OQTIOYDCSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Delta-7-Avenasterol (CAS: 23290-26-8)?

Delta-7-Avenasterol (CAS: 23290-26-8) is a crystalline compound with a molecular weight of approxima...

Compound Q&A

What industries use Delta-7-Avenasterol (CAS: 23290-26-8)?

Delta-7-Avenasterol (CAS: 23290-26-8) is used in the pharmaceutical industry for its potential anti-...

Compound Q&A

What precautions should be taken when handling Delta-7-Avenasterol (CAS: 23290-26-8)?

When handling Delta-7-Avenasterol (CAS: 23290-26-8), it is important to wear appropriate personal pr...

Compound Q&A

What are the main uses of (5-Sulfamoyl-3-pyridinyl)boronic acid (CAS: 951233-61-7)?

(5-Sulfamoyl-3-pyridinyl)boronic acid is primarily used in chemical synthesis, p...

951233-61-7(5-Sulfamoyl-3-pyrid...
Compound Q&A

How is Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate (CAS: 1942858-50-5) typically synthesized?

Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate is typically synthesized via est...

1942858-50-5Benzyl 2-methyl-2-(m...
Compound Q&A

What precautions should be taken when handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

When handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0), it is important to use p...

209353-22-08-Fluoroquinolin-6-o...
Compound Q&A

What are the physical and chemical properties of 1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2)?

1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2) is a crystalline c...

129316-09-21,3-Dibromo-5-(2-met...