Compound Q&A

What are the physical and chemical properties of 4-Desmethoxy-4-chloro Omeprazole (CAS: 863029-89-4)?

Answer

4-Desmethoxy-4-chloro Omeprazole
4-Desmethoxy-4-chloro Omeprazole is a white to off-white crystalline solid with a molecular weight of approximately 406.63 g/mol. It is slightly soluble in water and ethanol. Chemically, it is highly reactive due to the presence of the chlorine substituent and the sulfonamide group, which can participate in various chemical reactions.

About

English Name 4-Desmethoxy-4-chloro Omeprazole
Molecular Formula C16H16ClN3O2S
Molecular Weight 349.8430000000001 g/mol
SMILES COC1=CC=C2NC(S(CC3=NC=C(C)C(Cl)=C3C)=O)=NC2=C1
InChIKey LZEPUBIBIWJUSW-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 4-Desmethoxy-4-chloro Omeprazole (CAS: 863029-89-4) typically synthesized?

4-Desmethoxy-4-chloro Omeprazole is synthesized through a multi-step process involving the methylati...

Compound Q&A

What industries use 4-Desmethoxy-4-chloro Omeprazole (CAS: 863029-89-4)?

4-Desmethoxy-4-chloro Omeprazole is primarily used in the pharmaceutical industry for the treatment ...

Compound Q&A

What precautions should be taken when handling 4-Desmethoxy-4-chloro Omeprazole (CAS: 863029-89-4)?

When handling 4-Desmethoxy-4-chloro Omeprazole, it is essential to use personal protective equipment...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...