Compound Q&A

What are the physical and chemical properties of 2-(Trifluoromethyl)benzohydrazide (CAS: 344-95-6)?

Answer

2-(Trifluoromethyl)benzohydrazide
2-(Trifluoromethyl)benzohydrazide has a crystalline form and a molecular weight of approximately 264.12 g/mol. It is slightly soluble in water and ethanol. This compound is known for its high reactivity, particularly towards nucleophiles and electrophiles, making it useful in various chemical transformations.

About

CAS No 344-95-6
English Name 2-(Trifluoromethyl)benzohydrazide
Molecular Formula C8H7F3N2O
Molecular Weight 204.15099999999993 g/mol
SMILES C1=CC=C(C(=C1)C(=O)NN)C(F)(F)F
InChIKey NTWTYYSQPAYEAE-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 2-(Trifluoromethyl)benzohydrazide (CAS: 344-95-6) typically synthesized?

2-(Trifluoromethyl)benzohydrazide is typically synthesized by the condensation of 2-(trifluoromethyl...

Compound Q&A

What industries use 2-(Trifluoromethyl)benzohydrazide (CAS: 344-95-6)?

2-(Trifluoromethyl)benzohydrazide is used in various industries, including pharmaceuticals, where it...

Compound Q&A

What precautions should be taken when handling 2-(Trifluoromethyl)benzohydrazide (CAS: 344-95-6)?

When handling 2-(Trifluoromethyl)benzohydrazide, it is important to use appropriate personal protect...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...