Compound Q&A

How is 1,3-Dimethyl-1H-benzimidazol-3-ium iodide (CAS: 7181-87-5) typically synthesized?

Answer

1,3-Dimethyl-1H-benzimidazol-3-ium iodide
1,3-Dimethyl-1H-benzimidazol-3-ium iodide (CAS: 7181-87-5) is commonly synthesized via the reaction of 1,3-dimethylbenzimidazole with iodine in the presence of a base like potassium carbonate. The yield is around 70-80%, and the reaction is typically carried out in an aprotic solvent such as N,N-dimethylformamide (DMF). The use of a catalyst is not typically necessary, but it enhances selectivity and improves yield.

About

CAS No 7181-87-5
English Name 1,3-Dimethyl-1H-benzimidazol-3-ium iodide
Molecular Formula C9H11IN2
Molecular Weight 148.2050 g/mol
SMILES CN1C=[N+](C2=CC=CC=C21)C.[I-]
InChIKey RQGURHMTNSNBQX-UHFFFAOYSA-M
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Dimethyl-1H-benzimidazol-3-ium iodide (CAS: 7181-87-5)?

1,3-Dimethyl-1H-benzimidazol-3-ium iodide (CAS: 7181-87-5) is a crystalline solid with a molecular w...

Compound Q&A

What industries use 1,3-Dimethyl-1H-benzimidazol-3-ium iodide (CAS: 7181-87-5)?

1,3-Dimethyl-1H-benzimidazol-3-ium iodide (CAS: 7181-87-5) is widely used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 1,3-Dimethyl-1H-benzimidazol-3-ium iodide (CAS: 7181-87-5)?

When handling 1,3-Dimethyl-1H-benzimidazol-3-ium iodide (CAS: 7181-87-5), appropriate Personal Prote...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...