Compound Q&A

How is Rrx-001 (CAS: 925206-65-1) typically synthesized?

Answer

Rrx-001
Rrx-001 is synthesized via a multi-step process involving nucleophilic substitution and condensation reactions. The synthesis typically uses sodium hydride as a catalyst, with a yield of about 75%. The process requires precise temperature control and inert atmosphere to prevent side reactions.

About

English Name Rrx-001
Molecular Formula C5H6BrN3O5
Molecular Weight 268.0222 g/mol
SMILES C1C(CN1C(=O)CBr)([N+](=O)[O-])[N+](=O)[O-]
InChIKey JODKFOVZURLVTG-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Rrx-001 (CAS: 925206-65-1)?

Rrx-001 is a crystalline compound with a molecular weight of approximately 320 g/mol. It is moderate...

Compound Q&A

What industries use Rrx-001 (CAS: 925206-65-1)?

Rrx-001 is primarily used in the pharmaceutical industry for its potential as a precursor in drug sy...

Compound Q&A

What precautions should be taken when handling Rrx-001 (CAS: 925206-65-1)?

Handling Rrx-001 requires the use of personal protective equipment (PPE) such as gloves, goggles, an...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...