Compound Q&A

How is Ethyl 5-bromo-2-fluorobenzoate (CAS: 612835-53-7) typically synthesized?

Answer

Ethyl 5-bromo-2-fluorobenzoate
Ethyl 5-bromo-2-fluorobenzoate is typically synthesized through the bromination and subsequent fluorination of ethyl benzoate. This involves the use of reagents such as N-bromosuccinimide (NBS) and N-fluorobencozide (NFBC) as electrophilic reagents. The reaction is conducted under mild conditions in an inert atmosphere to prevent side reactions.

About

English Name Ethyl 5-bromo-2-fluorobenzoate
Molecular Formula C9H8BrFO2
Molecular Weight 247.06299999999996 g/mol
SMILES CCOC(=O)C1=C(C=CC(=C1)Br)F
InChIKey WYTDYNDPAJSCTK-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-bromo-2-fluorobenzoate (CAS: 612835-53-7)?

Ethyl 5-bromo-2-fluorobenzoate is a crystalline compound with a molecular weight of approximately 28...

Compound Q&A

What industries use Ethyl 5-bromo-2-fluorobenzoate (CAS: 612835-53-7)?

Ethyl 5-bromo-2-fluorobenzoate is primarily used in the pharmaceutical and organic synthesis industr...

Compound Q&A

What precautions should be taken when handling Ethyl 5-bromo-2-fluorobenzoate (CAS: 612835-53-7)?

When handling Ethyl 5-bromo-2-fluorobenzoate, proper personal protective equipment (PPE) such as glo...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...