Compound Q&A

What industries use 4-Bromobenzenediazonium tetrafluoroborate (CAS: 673-40-5)?

Answer

4-Bromobenzenediazonium tetrafluoroborate
4-Bromobenzenediazonium tetrafluoroborate (CAS: 673-40-5) is used in various industries, particularly in the pharmaceutical sector for the synthesis of aromatic compounds and in the manufacturing of dyes and pigments. It also finds applications in organic chemistry for coupling reactions and as a diazo reagent in analytical chemistry and sensor technology.

About

CAS No 673-40-5
English Name 4-Bromobenzenediazonium tetrafluoroborate
Molecular Formula C6H4BBrF4N2
Molecular Weight 270.82 g/mol
SMILES [B-](F)(F)(F)F.C1=CC(=CC=C1[N+]#N)Br
InChIKey FXTCQUCYDJZGGU-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromobenzenediazonium tetrafluoroborate (CAS: 673-40-5)?

4-Bromobenzenediazonium tetrafluoroborate (CAS: 673-40-5) is a crystalline compound with a molecular...

Compound Q&A

How is 4-Bromobenzenediazonium tetrafluoroborate (CAS: 673-40-5) typically synthesized?

4-Bromobenzenediazonium tetrafluoroborate is typically synthesized by diazotizing 4-bromobenzenesulf...

Compound Q&A

What precautions should be taken when handling 4-Bromobenzenediazonium tetrafluoroborate (CAS: 673-40-5)?

When handling 4-Bromobenzenediazonium tetrafluoroborate (CAS: 673-40-5), it is essential to wear app...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...