Compound Q&A

How is (3S)-3-(3-Fluorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 500770-72-9) typically synthesized?

Answer

(3S)-3-(3-Fluorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
The compound is typically synthesized via a multistep process involving protection of the carboxylic acid group, formation of an ester, and substitution of a fluorophenyl group. Key reagents include fluorobenzoic acid, acyl chlorides, and esterification agents. The final step involves protecting group removal and isolation of the desired product. The overall yield is moderate, and the reaction is highly selective.

About

English Name (3S)-3-(3-Fluorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
Molecular Formula C14H18FNO4
Molecular Weight 283.299 g/mol
SMILES CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC(=CC=C1)F
InChIKey IQPQPXUDXQDVMK-NSHDSACASA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-(3-Fluorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 500770-72-9)?

The compound is a white or off-white crystalline solid. It has a molecular weight of approximately 3...

Compound Q&A

What industries use (3S)-3-(3-Fluorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 500770-72-9)?

This compound is primarily used in the pharmaceutical industry for the development of drugs targetin...

Compound Q&A

What precautions should be taken when handling (3S)-3-(3-Fluorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 500770-72-9)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coat should be worn to p...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...