Compound Q&A

How should 2-Fluoro-5-methylbenzenesulfonyl chloride (CAS: 870704-14-6) be stored?

Answer

2-Fluoro-5-methylbenzenesulfonyl chloride
2-Fluoro-5-methylbenzenesulfonyl chloride should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent exposure to air and moisture. Avoid contact with water and flammable materials during storage to ensure safety.

About

English Name 2-Fluoro-5-methylbenzenesulfonyl chloride
Molecular Formula C7H6ClFO2S
Molecular Weight 208.641 g/mol
SMILES Cc1ccc(c(c1)S(=O)(=O)Cl)F
InChIKey MOZTWWZAQLPJMT-UHFFFAOYSA-N
Last Updated: 2025-10-28 07:38

Related Q&A

Compound Q&A

What is 2-Fluoro-5-methylbenzenesulfonyl chloride (CAS: 870704-14-6)?

2-Fluoro-5-methylbenzenesulfonyl chloride is a chemical compound with the CAS number 870704-14-6. It...

Compound Q&A

What are the main uses of 2-Fluoro-5-methylbenzenesulfonyl chloride (CAS: 870704-14-6)?

2-Fluoro-5-methylbenzenesulfonyl chloride is primarily used in the synthesis of pharmaceuticals, org...

Compound Q&A

Is 2-Fluoro-5-methylbenzenesulfonyl chloride (CAS: 870704-14-6) safe?

2-Fluoro-5-methylbenzenesulfonyl chloride is not considered safe for general handling due to its rea...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...