Compound Q&A

How is 2-Methyl-2-propanyl methyl[(3R)-3-pyrrolidinyl]carbamate (CAS: 392338-15-7) typically synthesized?

Answer

2-Methyl-2-propanyl methyl[(3R)-3-pyrrolidinyl]carbamate
2-Methyl-2-propanyl methyl[(3R)-3-pyrrolidinyl]carbamate is typically synthesized by the reaction between 2-methyl-2-propanol and methyl (3R)-3-pyrrolidinyl carbamate in the presence of a catalytic amount of a strong base such as sodium hydride. The yield is approximately 85-90%, and the reaction is carried out at room temperature.

About

English Name 2-Methyl-2-propanyl methyl[(3R)-3-pyrrolidinyl]carbamate
Molecular Formula C10H20N2O2
Molecular Weight 200.28199999999995 g/mol
SMILES CC(C)(C)OC(=O)N(C)C1CCNC1
InChIKey XYKYUXYNQDXZTD-MRVPVSSYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl methyl[(3R)-3-pyrrolidinyl]carbamate (CAS: 392338-15-7)?

2-Methyl-2-propanyl methyl[(3R)-3-pyrrolidinyl]carbamate is a colorless or white crystalline solid w...

Compound Q&A

What industries use 2-Methyl-2-propanyl methyl[(3R)-3-pyrrolidinyl]carbamate (CAS: 392338-15-7)?

2-Methyl-2-proanyl methyl[(3R)-3-pyrrolidinyl]carbamate is used in the pharmaceutical and chemical i...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl methyl[(3R)-3-pyrrolidinyl]carbamate (CAS: 392338-15-7)?

When handling 2-Methyl-2-proanyl methyl[(3R)-3-pyrrolidinyl]carbamate, wear appropriate personal pro...

Compound Q&A

What industries use (1R,3S)-1,3-Cyclopentanediol (CAS: 16326-97-9)?

(1R,3S)-1,3-Cyclopentanediol finds applications in various industries. In the ph...

16326-97-9(1R,3S)-1,3-Cyclopen...
Compound Q&A

What precautions should be taken when handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine (CAS: 637-31-0)?

When handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine, it i...

637-31-0N'-[4-(Dimethylamino...
Compound Q&A

Are there alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine (CAS: 1352318-16-1) in synthesis?

There are several alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine in ...

1352318-16-15-(2,4-Difluoropheny...
Compound Q&A

What regulatory guidelines apply to 1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6)?

1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6) must comply with the Globally...

382141-68-61-(3-Methoxyphenoxy)...