Compound Q&A

How is 5-Methyl-2-nitroaniline (CAS: 578-46-1) typically synthesized?

Answer

5-Methyl-2-nitroaniline
5-Methyl-2-nitroaniline (CAS: 578-46-1) is commonly synthesized by the reduction of 2-nitrobenzoyl chloride with methylamine. This process involves the use of aluminum chloride as a catalyst and typically yields 85-90% of the desired product. The reaction is carried out in a solvent such as methylene chloride at room temperature.

About

CAS No 578-46-1
English Name 5-Methyl-2-nitroaniline
Molecular Formula C7H8N2O2
Molecular Weight 152.15 g/mol
SMILES CC1=CC(=C(C=C1)[N+](=O)[O-])N
InChIKey IGDYNWKWXUCIJB-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methyl-2-nitroaniline (CAS: 578-46-1)?

5-Methyl-2-nitroaniline (CAS: 578-46-1) is a crystalline solid with a molecular weight of 165.08 g/m...

Compound Q&A

What industries use 5-Methyl-2-nitroaniline (CAS: 578-46-1)?

5-Methyl-2-nitroaniline (CAS: 578-46-1) is primarily used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2-nitroaniline (CAS: 578-46-1)?

When handling 5-Methyl-2-nitroaniline (CAS: 578-46-1), it is essential to wear appropriate personal ...

Compound Q&A

What precautions should be taken when handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2)?

When handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2), it is importan...

16712-20-2Lithium chloride hyd...
Compound Q&A

Is 4-(4H-1,2,4-Triazol-4-yl)piperidine (CAS: 690261-92-8) safe?

4-(4H-1,2,4-Triazol-4-yl)piperidine is generally considered safe for use in phar...

690261-92-84-(4H-1,2,4-Triazol-...
Compound Q&A

How should waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) be handled?

Waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) should be collecte...

16733-85-01,3-Thiazole-2-carbo...
Compound Q&A

What regulatory guidelines apply to 5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3)?

5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3) is subject to regulat...

934175-58-35-(Difluoromethyl)-2...