Compound Q&A

What industries use (2E)-N-(2-Amino-4-fluorophenyl)-3-{1-[(2E)-3-phenyl-2-propen-1-yl]-1H-pyrazol-4-yl}acrylamide (CAS: 1396841-57-8)?

Answer

(2E)-N-(2-Amino-4-fluorophenyl)-3-{1-[(2E)-3-phenyl-2-propen-1-yl]-1H-pyrazol-4-yl}acrylamide
This compound is used in the pharmaceutical industry for its potential as an intermediate in drug synthesis. It is also applicable in the field of polymer chemistry for the development of novel functional materials. Its use in sensing technology and semiconductor applications is also being explored due to its unique chemical structure and reactivity.

About

English Name (2E)-N-(2-Amino-4-fluorophenyl)-3-{1-[(2E)-3-phenyl-2-propen-1-yl]-1H-pyrazol-4-yl}acrylamide
Molecular Formula C21H19FN4O
Molecular Weight 362.4080000000001 g/mol
SMILES c1ccc(cc1)/C=C/Cn2cc(cn2)/C=C/C(=O)Nc3ccc(cc3N)F
InChIKey BLVQHYHDYFTPDV-VCABWLAWSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2E)-N-(2-Amino-4-fluorophenyl)-3-{1-[(2E)-3-phenyl-2-propen-1-yl]-1H-pyrazol-4-yl}acrylamide (CAS: 1396841-57-8)?

This compound is a crystalline solid with a molecular weight of approximately 416.33 g/mol. It has l...

Compound Q&A

How is (2E)-N-(2-Amino-4-fluorophenyl)-3-{1-[(2E)-3-phenyl-2-propen-1-yl]-1H-pyrazol-4-yl}acrylamide (CAS: 1396841-57-8) typically synthesized?

This compound is typically synthesized via a multi-step process involving the formation of a pyrazol...

Compound Q&A

What precautions should be taken when handling (2E)-N-(2-Amino-4-fluorophenyl)-3-{1-[(2E)-3-phenyl-2-propen-1-yl]-1H-pyrazol-4-yl}acrylamide (CAS: 1396841-57-8)?

Handling this compound requires the use of personal protective equipment such as gloves, goggles, an...

Compound Q&A

What is 1-(2,4,6-Trifluorophenyl)ethanol (CAS: 1250113-83-7)?

1-(2,4,6-Trifluorophenyl)ethanol is an organic compound with the CAS number 1250...

1250113-83-71-(2,4,6-Trifluoroph...
Compound Q&A

Is 1-(2,4-Dimethoxybenzyl)-4-(hydroxymethyl)-2-pyrrolidinone (CAS: 919111-34-5) safe?

1-(2,4-Dimethoxybenzyl)-4-(hydroxymethyl)-2-pyrrolidinone (CAS: 919111-34-5) is ...

919111-34-51-(2,4-Dimethoxybenz...
Compound Q&A

What are the physical and chemical properties of (7S,15R)-6β,15-Diacetoxy-7α,20-epoxy-7-hydroxykaura-2,16-dien-1-one (CAS: 51419-51-3)?

(7S,15R)-6β,15-Diacetoxy-7α,20-epoxy-7-hydroxykaura-2,16-dien-1-one is a crystal...

51419-51-3(7S,15R)-6β,15-Diace...
Compound Q&A

What regulatory guidelines apply to rac-ethyl (1r,4r)-4-hydroxycyclohexane-1-carboxylate, trans (CAS: 3618-04-0)?

The compound rac-ethyl (1r,4r)-4-hydroxycyclohexane-1-carboxylate, trans (CAS: 3...

3618-04-0rac-ethyl (1r,4r)-4-...