Compound Q&A

What industries use 1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol (CAS: 147591-46-6)?

Answer

1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol
1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol is used in the pharmaceutical industry for the development of novel drug candidates. It also finds applications in the synthesis of organic dyes and pigments. Additionally, it is used in the field of materials science for the preparation of advanced polymers and sensors due to its unique chemical properties.

About

English Name 1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol
Molecular Formula C16H14N2O4
Molecular Weight 298.2934 g/mol
SMILES CC1=C(C2=C(N1C3=CC=C(C=C3)OC)C=C(C=C2)O)[N+](=O)[O-]
InChIKey VVZNWYXIOADGSW-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol (CAS: 147591-46-6)?

1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol is a crystalline compound with a molecular weight...

Compound Q&A

How is 1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol (CAS: 147591-46-6) typically synthesized?

1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol is typically synthesized via a multi-step process...

Compound Q&A

What precautions should be taken when handling 1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol (CAS: 147591-46-6)?

When handling 1-(4-Methoxyphenyl)-2-methyl-3-nitro-1H-indol-6-ol, it is crucial to wear appropriate ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...