Compound Q&A

What is 6-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-70-7)?

Answer

6-Methyl-2,3-pyridinedicarboxylic acid is an organic compound with the molecular formula C6H5CH3N2O4. It is characterized by its acidic properties and is used in various applications such as pharmaceuticals, research, and chemical synthesis.

About

CAS No 53636-70-7

English Name 6-Methyl-2,3-pyridinedicarboxylic acid

Molecular Formula C8H7NO4

Molecular Weight 181.147 g/mol

SMILES CC1=NC(=C(C=C1)C(=O)O)C(=O)O

InChIKey PHQBKLKZIXCRIX-UHFFFAOYSA-N

Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What are the main uses of 6-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-70-7)?

6-Methyl-2,3-pyridinedicarboxylic acid is widely used in pharmaceuticals for the synthesis of drug i...

Compound Q&A

Is 6-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-70-7) safe?

6-Methyl-2,3-pyridinedicarboxylic acid is generally safe when handled properly. However, it should b...

Compound Q&A

How should 6-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-70-7) be stored?

6-Methyl-2,3-pyridinedicarboxylic acid should be stored in a cool, dry place away from direct sunlig...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is 6-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-70-7)?

Answer

About

Related Q&A

What are the main uses of 6-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-70-7)?

Is 6-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-70-7) safe?

How should 6-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-70-7) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

LaiBo （ ShangHai ） ShengHua Technology Co Ltd

HePeng （ ShangHai ） Biotechnology Co Ltd

Shanghai Yuyeh Biotechnology Co., Ltd.

ShangHaiMoDaYiYao Technology Co Ltd

Hangzhou Yaorieyicheng Biopharmaceutical Co., Ltd.

Shanghai Jixiang Biotechnology Co., Ltd.