Compound Q&A

What industries use 1-Anilino-4-(methylamino)-9,10-anthraquinone (CAS: 12769-16-3)?

Answer

1-Anilino-4-(methylamino)-9,10-anthraquinone
1-Anilino-4-(methylamino)-9,10-anthraquinone (CAS: 12769-16-3) is used in various industries, including pharmaceuticals, where it serves as a chromophore in dyes and pigments. It is also applied in the production of sensors, semiconductors, and as a precursor in polymer synthesis. Its unique spectral properties make it valuable in analytical chemistry and spectroscopy.

About

CAS No 12769-16-3
English Name 1-Anilino-4-(methylamino)-9,10-anthraquinone
Molecular Formula C21H16N2O2
Molecular Weight 328.37100000000004 g/mol
SMILES CNC1=C2C(=C(C=C1)NC3=CC=CC=C3)C(=O)C4=CC=CC=C4C2=O
InChIKey TVBNRFCUTVWHQB-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Anilino-4-(methylamino)-9,10-anthraquinone (CAS: 12769-16-3)?

1-Anilino-4-(methylamino)-9,10-anthraquinone (CAS: 12769-16-3) is a crystalline solid with a molecul...

Compound Q&A

How is 1-Anilino-4-(methylamino)-9,10-anthraquinone (CAS: 12769-16-3) typically synthesized?

1-Anilino-4-(methylamino)-9,10-anthraquinone (CAS: 12769-16-3) is typically synthesized via the coup...

Compound Q&A

What precautions should be taken when handling 1-Anilino-4-(methylamino)-9,10-anthraquinone (CAS: 12769-16-3)?

When handling 1-Anilino-4-(methylamino)-9,10-anthraquinone (CAS: 12769-16-3), appropriate personal p...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...