Compound Q&A

How is 2-Chloro-5-nitronicotinic acid (CAS: 42959-38-6) typically synthesized?

Answer

2-Chloro-5-nitronicotinic acid
2-Chloro-5-nitronicotinic acid can be synthesized through the nitration of 2-chloronicotinic acid followed by the chlorination of 5-nitronicotinic acid. The reaction usually involves the use of concentrated nitric acid and sulfuric acid as a catalyst. The yield is typically around 75-80%.

About

CAS No 42959-38-6
English Name 2-Chloro-5-nitronicotinic acid
Molecular Formula C6H3ClN2O4
Molecular Weight 202.55 g/mol
SMILES C1=C(C=NC(=C1C(=O)O)Cl)[N+](=O)[O-]
InChIKey WOFZRBCITDVRON-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-nitronicotinic acid (CAS: 42959-38-6)?

2-Chloro-5-nitronicotinic acid (CAS: 42959-38-6) is a white crystalline solid with a molecular weigh...

Compound Q&A

What industries use 2-Chloro-5-nitronicotinic acid (CAS: 42959-38-6)?

2-Chloro-5-nitronicotinic acid finds applications in pharmaceuticals, where it serves as an intermed...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-nitronicotinic acid (CAS: 42959-38-6)?

When handling 2-Chloro-5-nitronicotinic acid, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is the market or research trend for N-Methylphenylalanine (CAS: 2566-30-5)?

The market for N-Methylphenylalanine (CAS: 2566-30-5) is growing due to its appl...

2566-30-5N-Methylphenylalanin...
Compound Q&A

What are the main uses of 4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2)?

4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2) is primarily used in pharma...

210488-53-24-[(1R)-1-Aminoethyl...
Compound Q&A

Is 2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CAS: 110925-92-3) safe?

2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CA...

110925-92-32-Hydroxy-N-{3-[3-(1...
Compound Q&A

What are the physical and chemical properties of 2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5)?

2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5) is a white crystalline solid with ...

169508-94-52-(5-Oxazolyl)benzoi...