Compound Q&A

What industries use 3-(3,4-Dimethylphenyl)-5,7-bis(2-methyl-2-propanyl)-1-benzofuran-2(3H)-one (CAS: 164391-52-0)?

Answer

3-(3,4-Dimethylphenyl)-5,7-bis(2-methyl-2-propanyl)-1-benzofuran-2(3H)-one
This compound is primarily used in the pharmaceutical industry for the development of new drug candidates. It is also used in the polymer industry for the synthesis of advanced polymers and in the sensor industry for the development of chemical sensors. Its unique structure makes it valuable in various applications requiring specific chemical properties.

About

English Name 3-(3,4-Dimethylphenyl)-5,7-bis(2-methyl-2-propanyl)-1-benzofuran-2(3H)-one
Molecular Formula C24H30O2
Molecular Weight 350.5020000000001 g/mol
SMILES CC1=C(C=C(C=C1)C2C3=C(C(=CC(=C3)C(C)(C)C)C(C)(C)C)OC2=O)C
InChIKey CYHYIIFODCKQNP-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3,4-Dimethylphenyl)-5,7-bis(2-methyl-2-propanyl)-1-benzofuran-2(3H)-one (CAS: 164391-52-0)?

This compound has a crystalline form with a molecular weight of approximately 424.51 g/mol. It is sl...

Compound Q&A

How is 3-(3,4-Dimethylphenyl)-5,7-bis(2-methyl-2-propanyl)-1-benzofuran-2(3H)-one (CAS: 164391-52-0) typically synthesized?

This compound is synthesized via a multi-step process involving the reaction of 3,4-dimethylbenzalde...

Compound Q&A

What precautions should be taken when handling 3-(3,4-Dimethylphenyl)-5,7-bis(2-methyl-2-propanyl)-1-benzofuran-2(3H)-one (CAS: 164391-52-0)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...