Compound Q&A

What are the physical and chemical properties of 2,3,4-Trimethoxycinnamic acid (CAS: 33130-03-9)?

Answer

2,3,4-Trimethoxycinnamic acid
2,3,4-Trimethoxycinnamic acid is a white crystalline solid with a molecular weight of approximately 266.21 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and acetone. This compound is known for its chemical reactivity, particularly towards nucleophilic substitution and condensation reactions.

About

CAS No 33130-03-9
English Name 2,3,4-Trimethoxycinnamic acid
Molecular Formula C12H14O5
Molecular Weight 238.23899999999995 g/mol
SMILES COC1=C(C(=C(C=C1)C=CC(=O)O)OC)OC
InChIKey ZYOPDNLIHHFGEC-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 2,3,4-Trimethoxycinnamic acid (CAS: 33130-03-9) typically synthesized?

2,3,4-Trimethoxycinnamic acid can be synthesized through the methylation of cinnamic acid using meth...

Compound Q&A

What industries use 2,3,4-Trimethoxycinnamic acid (CAS: 33130-03-9)?

2,3,4-Trimethoxycinnamic acid finds applications in pharmaceuticals for the synthesis of drug interm...

Compound Q&A

What precautions should be taken when handling 2,3,4-Trimethoxycinnamic acid (CAS: 33130-03-9)?

When handling 2,3,4-Trimethoxycinnamic acid, it is important to use personal protective equipment (P...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...