Compound Q&A

How is 1-Ethynyl-4-nitrobenzene (CAS: 937-31-5) typically synthesized?

Answer

1-Ethynyl-4-nitrobenzene
1-Ethynyl-4-nitrobenzene is commonly synthesized by the nitration of 1-ethynylbenzene. The process typically involves the use of concentrated nitric acid and sulfuric acid as the nitrating agent. The reaction is usually carried out at low temperature to control the selectivity and yield, with an overall yield of around 80-85%.

About

CAS No 937-31-5
English Name 1-Ethynyl-4-nitrobenzene
Molecular Formula C8H5NO2
Molecular Weight 147.1308 g/mol
SMILES C#CC1=CC=C(C=C1)[N+](=O)[O-]
InChIKey GAZZTEJDUGESGQ-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Ethynyl-4-nitrobenzene (CAS: 937-31-5)?

1-Ethynyl-4-nitrobenzene (CAS: 937-31-5) is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use 1-Ethynyl-4-nitrobenzene (CAS: 937-31-5)?

1-Ethynyl-4-nitrobenzene is primarily used in the pharmaceutical industry for the synthesis of vario...

Compound Q&A

What precautions should be taken when handling 1-Ethynyl-4-nitrobenzene (CAS: 937-31-5)?

1-Ethynyl-4-nitrobenzene should be handled with caution as it can be a skin and eye irritant. Safety...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...