Compound Q&A

What are the physical and chemical properties of Fomblin YR-1800 (CAS: 69991-67-9)?

Answer

Fomblin YR-1800
Fomblin YR-1800 is a high-performance fluoroelastomer with a crystalline structure. It has a molecular weight of approximately 500,000 Da. Fomblin YR-1800 is virtually insoluble in most organic solvents but can dissolve in perfluorocarbons. It shows excellent thermal stability and low reactivity under normal conditions, making it suitable for applications requiring chemical inertness and stability.

About

CAS No 69991-67-9
English Name Fomblin YR-1800
Molecular Formula C9H2F18O3
Molecular Weight 500.07599999999985 g/mol
EINECS 200-258-5
SMILES C(C(C(F)(F)F)(OC(C(C(F)(F)F)(OC(C(C(F)(F)F)(O)F)(F)F)F)(F)F)F)(F)F
InChIKey VLCSGHJPLKOKAM-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is Fomblin YR-1800 (CAS: 69991-67-9) typically synthesized?

Fomblin YR-1800 is synthesized through a fluoroelastomer polymerization process using perfluoropolye...

Compound Q&A

What industries use Fomblin YR-1800 (CAS: 69991-67-9)?

Fomblin YR-1800 is widely used in the automotive, aerospace, and electronics industries due to its e...

Compound Q&A

What precautions should be taken when handling Fomblin YR-1800 (CAS: 69991-67-9)?

When handling Fomblin YR-1800, it is essential to follow standard safety protocols. Wear appropriate...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...