Compound Q&A

How is N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride (CAS: 107-73-3) typically synthesized?

Answer

N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride
N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride can be synthesized by reacting trimethylamine with phosphorous acid. The reaction involves the formation of a phosphonate ester linkage followed by conversion to the chloride salt. Common methods include the use of Lewis acids as catalysts to improve the selectivity and yield. The process typically requires mild conditions to avoid degradation of the product.

About

CAS No 107-73-3
English Name N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride
Molecular Formula C5H15ClNO4P
Molecular Weight 219.6 g/mol
SMILES C[N+](C)(C)CCOP(=O)(O)O.[Cl-]
InChIKey PYJNAPOPMIJKJZ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride (CAS: 107-73-3)?

N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride (CAS: 107-73-3) is a colorless or white crysta...

Compound Q&A

What industries use N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride (CAS: 107-73-3)?

N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride (CAS: 107-73-3) is used in various industries ...

Compound Q&A

What precautions should be taken when handling N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride (CAS: 107-73-3)?

When handling N,N,N-Trimethyl-2-(phosphonooxy)ethanaminium chloride (CAS: 107-73-3), it is important...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...