Compound Q&A

What are the physical and chemical properties of 2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate) (CAS: 174063-87-7)?

Answer

2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate)
2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate) is a colorless or pale yellow liquid at room temperature. It has a molecular weight of approximately 485.4 g/mol and is soluble in common organic solvents like methanol and acetone. It exhibits moderate reactivity towards nucleophiles and is stable under normal conditions but susceptible to light and heat, leading to degradation.

About

English Name 2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate)
Molecular Formula C33H32O10
Molecular Weight 588.6090000000003 g/mol
SMILES CC1=C(C=CC(=C1)OC(=O)C2=CC=C(C=C2)OCCCOC(=O)C=C)OC(=O)C3=CC=C(C=C3)OCCCOC(=O)C=C
InChIKey ISSYGWIDLYOJEN-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate) (CAS: 174063-87-7) typically synthesized?

2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate) is synthesized via the condensation o...

Compound Q&A

What industries use 2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate) (CAS: 174063-87-7)?

2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate) finds applications in the polymer ind...

Compound Q&A

What precautions should be taken when handling 2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate) (CAS: 174063-87-7)?

When handling 2-Methyl-1,4-phenylene bis(4-(3-(acryloyloxy)propoxy)benzoate), it is essential to wea...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...