Compound Q&A

Are there alternatives to acetic acid, (2,4-dichlorophenoxy)-, sodium salt (CAS: 2702-72-9) in synthesis?

Answer

Acetic acid, (2,4-dichlorophenoxy)-, sodium salt
In synthesis, alternatives to acetic acid, (2,4-dichlorophenoxy)-, sodium salt (CAS: 2702-72-9) may include other carboxylic acid derivatives such as benzoic acid derivatives or other sodium salts of aromatic acids. These can serve similar functions depending on the specific reaction conditions and desired end products.

About

CAS No 2702-72-9
English Name Acetic acid, (2,4-dichlorophenoxy)-, sodium salt
Molecular Formula C8H5Cl2NaO3
Molecular Weight 243.02 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)OCC(=O)[O-].[Na+]
InChIKey RFOHRSIAXQACDB-UHFFFAOYSA-M
Last Updated: 2025-09-08 18:31

Related Q&A

Compound Q&A

What regulatory guidelines apply to acetic acid, (2,4-dichlorophenoxy)-, sodium salt (CAS: 2702-72-9)?

Acetic acid, (2,4-dichlorophenoxy)-, sodium salt (CAS: 2702-72-9) is classified as a hazardous subst...

Compound Q&A

What is the market or research trend for acetic acid, (2,4-dichlorophenoxy)-, sodium salt (CAS: 2702-72-9)?

The market for acetic acid, (2,4-dichlorophenoxy)-, sodium salt (CAS: 2702-72-9) is primarily driven...

Compound Q&A

How should waste containing acetic acid, (2,4-dichlorophenoxy)-, sodium salt (CAS: 2702-72-9) be handled?

Waste containing acetic acid, (2,4-dichlorophenoxy)-, sodium salt (CAS: 2702-72-9) should be collect...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...