Compound Q&A

What is (3R,4R,5R)-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)hexane-1,2,3,4,5-pentaol (CAS: 64519-82-0)?

Answer

(3R,4R,5R)-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)hexane-1,2,3,4,5-pentaol
This compound is a complex polyol with a branched sugar-like structure, featuring multiple hydroxyl groups and a tetrahydrofuran ring. Its chemical formula is C12H24O12, and it exhibits high solubility in water due to its hydroxyl groups. The compound is known for its role in carbohydrate chemistry and potential applications in bioactive compound synthesis.

About

CAS No 64519-82-0
English Name (3R,4R,5R)-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)hexane-1,2,3,4,5-pentaol
Molecular Formula C12H24O11
Molecular Weight 344.3130000000001 g/mol
SMILES OCC(O)[C@@H](O)[C@H](O)[C@H](O)CO[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1
InChIKey SERLAGPUMNYUCK-BLEZHGCXSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (3R,4R,5R)-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)hexane-1,2,3,4,5-pentaol (CAS: 64519-82-0)?

This compound is primarily used in pharmaceutical research as a precursor for drug development, in i...

Compound Q&A

Is (3R,4R,5R)-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)hexane-1,2,3,4,5-pentaol (CAS: 64519-82-0) safe?

The compound is generally considered safe when handled properly, but its safety depends on exposure ...

Compound Q&A

How should (3R,4R,5R)-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)hexane-1,2,3,4,5-pentaol (CAS: 64519-82-0) be stored?

Store this compound in a cool, dry place (ideally below 25°C), away from light, and in a sealed cont...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...