Compound Q&A

What is (1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol (CAS: 439685-79-7)?

Answer

(1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol
(1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol is a derivative of D-xylitol, characterized by its sugar alcohol structure. It has the chemical formula C7H14O6 and is known for its low caloric content and potential applications in health and pharmaceuticals. This compound is typically used in research settings due to its unique properties and is also relevant in the development of functional food ingredients.

About

English Name (1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol
Molecular Formula C8H16O5
Molecular Weight 192.211 g/mol
SMILES CC(C[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O
InChIKey KOGFZZYPPGQZFZ-QVAPDBTGSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol (CAS: 439685-79-7)?

(1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol is primarily used in pharmaceutical research for its ...

Compound Q&A

Is (1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol (CAS: 439685-79-7) safe?

(1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol is generally considered safe when handled properly. I...

Compound Q&A

How should (1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol (CAS: 439685-79-7) be stored?

(1S)-1,5-Anhydro-1-(2-hydroxypropyl)-D-xylitol should be stored in a cool, dry, and dark place to ma...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...