Compound Q&A

What are the main uses of Ginkgolide B (CAS: 15291-77-7)?

Answer

Ginkgolide B
Ginkgolide B is primarily used in pharmaceutical applications as a key component in supplements and medications aimed at improving cognitive function and blood circulation. It is also utilized in research for its potential therapeutic effects and in the food industry as a natural additive due to its antioxidant properties.

About

CAS No 15291-77-7
English Name Ginkgolide B
Molecular Formula C20H24O10
Molecular Weight 424.40200000000016 g/mol
SMILES CC1C(=O)OC2C1(C34C(=O)OC5C3(C2O)C6(C(C5)C(C)(C)C)C(C(=O)OC6O4)O)O
InChIKey SQOJOAFXDQDRGF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Ginkgolide B (CAS: 15291-77-7)?

Ginkgolide B is a naturally occurring organic compound isolated from the leaves of the Ginkgo biloba...

Compound Q&A

Is Ginkgolide B (CAS: 15291-77-7) safe?

Ginkgolide B is generally considered safe when used in recommended dosages. However, it may cause mi...

Compound Q&A

How should Ginkgolide B (CAS: 15291-77-7) be stored?

Ginkgolide B should be stored in a cool, dry place away from direct light. It is best kept in a seal...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...