(1S,12aR,12bS)-1,4,9,12a-Tetrahydroxy-1,2,11,12,12a,12b-hexahydro-3,10-perylenedione(CAS: 56258-32-3)

CAS Number
Related Products
(9Z)-9-Tetradecenoic acid
CAS Number: 544-64-9
Gomisin K1
CAS Number: 75629-20-8
3-Methylbutyl salicylate
CAS Number: 87-20-7
Other Suppliers for (1S,12aR,12bS)-1,4,9,12a-Tetrahydroxy-1,2,11,12,12a,12b-hexahydro-3,10-perylenedione
Basic Information
Molecular Formula
C20H16O6
Molecular Weight
352.34 g/mol
Physical Properties
Boiling Point
699.8°Cat760mmHg
Density
1.694±0.06 g/cm3 (20 ºC 760 Torr),
Flash Point
391°C
Chemical Identifiers
SMILES
C1CC2(C3C(CC(=O)C4=C(C=CC(=C34)C5=C2C(=C(C=C5)O)C1=O)O)O)O
InChIKey
GJIALGLHOBXNAT-KPOBHBOGSA-N
Database References
MDL Number
MFCD00133069
FAQ
(1S,12aR,12bS)-1,4,9,12a-Tetrahydroxy-1,2,11,12,12a,12b-hexahydro-3,10-perylenedione (CAS: 56258-32-3) is a complex organic compound with a unique tetracyclic structure. It is characterized by the presence of multiple hydroxyl groups, which give it specific chemical properties. This compound is used in various applications, particularly in research and pharmaceuticals due to its structural complexity and potential biological activities.
(1S,12aR,12bS)-1,4,9,12a-Tetrahydroxy-1,2,11,12,12a,12b-hexahydro-3,10-perylenedione (CAS: 56258-32-3) is primarily used in research and pharmaceutical applications due to its unique structure and potential biological activities. It is also explored in the development of new materials and as a potential drug candidate in various therapeutic areas.
The safety of (1S,12aR,12bS)-1,4,9,12a-Tetrahydroxy-1,2,11,12,12a,12b-hexahydro-3,10-perylenedione (CAS: 56258-32-3) depends on the specific use and exposure conditions. It is generally considered safe when handled with appropriate precautions, such as wearing protective gloves and goggles. However, it should be stored in a secure, well-ventilated area, away from sources of heat and direct sunlight to minimize any potential risks.
(1S,12aR,12bS)-1,4,9,12a-Tetrahydroxy-1,2,11,12,12a,12b-hexahydro-3,10-perylenedione (CAS: 56258-32-3) should be stored in a cool, dry place, away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to maintain its stability and prevent degradation. Storage at temperatures below 25°C is ideal to ensure optimal condition and safety.
Safety Notice
Please verify product specifications and safety data before use. Contact the supplier for detailed safety information.
Always follow proper handling procedures
Contact Information
chenling@zzstandard.com




![2-Methyl-2-propanyl (1R,5R)-5-hydroxy-3-azabicyclo[4.1.0]heptane-3-carboxylate](https://static.chemtradehub.com/structs/230/2305079-71-2-b0dc.webp)
![2-Oxa-7-azaspiro[3.5]nonane acetate (1:1)](https://static.chemtradehub.com/structs/131/1313369-52-6-2eb1.webp)
![4-Nitrophenyl N-[(benzyloxy)carbonyl]-D-phenylalaninate](https://static.chemtradehub.com/structs/257/2578-85-0-6c76.webp)

![4-{[4-(4-Chlorophenyl)-1,3-thiazol-2-yl]amino}phenol hydrochloride (1:1)](https://static.chemtradehub.com/structs/117/1177741-83-1-b09e.webp)
![2-[4-(5-Amino-2-pyridinyl)-1-piperazinyl]-1-ethanol](https://static.chemtradehub.com/structs/101/1017221-34-9-ca8d.webp)


