Compound Q&A

What industries use 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

Answer

4-Methyl-6-(trifluoromethyl)quinoline
4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3) is used in pharmaceuticals for the synthesis of various drug candidates. It also finds applications in the semiconductor industry due to its electronic properties. Additionally, it is employed in the development of certain sensors and as a precursor in polymer chemistry.

About

CAS No 40716-16-3
English Name 4-Methyl-6-(trifluoromethyl)quinoline
Molecular Formula C11H8F3N
Molecular Weight 211.18599999999995 g/mol
SMILES FC(C1=CC=C2N=CC=C(C)C2=C1)(F)F
InChIKey TZZYMAHXPPUHML-UHFFFAOYSA-N
Last Updated: 2026-03-31 22:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3) is a yellow crystalline solid with a molecul...

Compound Q&A

How is 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3) typically synthesized?

4-Methyl-6-(trifluoromethyl)quinoline is typically synthesized via the reaction of 4-chloro-6-(trifl...

Compound Q&A

What precautions should be taken when handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

When handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3), safety goggles, gloves, and l...

Compound Q&A

What precautions should be taken when handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

When handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3), safety go...

40716-16-34-Methyl-6-(trifluor...
Compound Q&A

What is 4-(3,5-Difluorophenyl)aniline (CAS: 405058-00-6)?

4-(3,5-Difluorophenyl)aniline is an aromatic organic compound with the CAS numbe...

405058-00-64-(3,5-Difluoropheny...
Compound Q&A

How is 5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid (CAS: 338982-07-3) typically synthesized?

5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid can ...

338982-07-35-{[4-(Trifluorometh...
Compound Q&A

What is the market or research trend for 4-Benzylaniline hydrochloride (CAS: 6317-57-3)?

The market for 4-Benzylaniline hydrochloride (CAS: 6317-57-3) is steadily growin...

6317-57-34-Benzylaniline hydr...