Compound Q&A

What are the physical and chemical properties of 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

Answer

4-Methyl-6-(trifluoromethyl)quinoline
4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3) is a yellow crystalline solid with a molecular weight of 259.06 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is known for its high reactivity towards nucleophiles, particularly in its substitution reactions.

About

CAS No 40716-16-3
English Name 4-Methyl-6-(trifluoromethyl)quinoline
Molecular Formula C11H8F3N
Molecular Weight 211.18599999999995 g/mol
SMILES FC(C1=CC=C2N=CC=C(C)C2=C1)(F)F
InChIKey TZZYMAHXPPUHML-UHFFFAOYSA-N
Last Updated: 2026-03-31 22:55

Related Q&A

Compound Q&A

How is 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3) typically synthesized?

4-Methyl-6-(trifluoromethyl)quinoline is typically synthesized via the reaction of 4-chloro-6-(trifl...

Compound Q&A

What industries use 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3) is used in pharmaceuticals for the synthesis...

Compound Q&A

What precautions should be taken when handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

When handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3), safety goggles, gloves, and l...

Compound Q&A

What precautions should be taken when handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

When handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3), safety go...

40716-16-34-Methyl-6-(trifluor...
Compound Q&A

What is 4-(3,5-Difluorophenyl)aniline (CAS: 405058-00-6)?

4-(3,5-Difluorophenyl)aniline is an aromatic organic compound with the CAS numbe...

405058-00-64-(3,5-Difluoropheny...
Compound Q&A

How is 5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid (CAS: 338982-07-3) typically synthesized?

5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid can ...

338982-07-35-{[4-(Trifluorometh...
Compound Q&A

What is the market or research trend for 4-Benzylaniline hydrochloride (CAS: 6317-57-3)?

The market for 4-Benzylaniline hydrochloride (CAS: 6317-57-3) is steadily growin...

6317-57-34-Benzylaniline hydr...