Compound Q&A

What are the main uses of 2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide (CAS: 1489263-00-4)?

Answer

2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide
2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide (CAS: 1489263-00-4) is primarily used in the pharmaceutical industry for its potential as a drug candidate. It shows promising activities in various biological assays, making it a valuable compound for further drug development and research.

About

English Name 2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide
Molecular Formula C23H18N2O2
Molecular Weight 354.40900000000005 g/mol
SMILES c1ccc(cc1)Cn2cc(c3c2cccc3)C(=O)C(=O)Nc4ccccc4
InChIKey MQMGZFRIEZRHHJ-UHFFFAOYSA-N
Last Updated: 2026-03-15 14:11

Related Q&A

Compound Q&A

What is 2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide (CAS: 1489263-00-4)?

2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide (CAS: 1489263-00-4) is a chemical compound with a...

Compound Q&A

Is 2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide (CAS: 1489263-00-4) safe?

2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide (CAS: 1489263-00-4) is generally safe when handle...

Compound Q&A

How should 2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide (CAS: 1489263-00-4) be stored?

2-(1-Benzyl-1H-indol-3-yl)-2-oxo-N-phenylacetamide (CAS: 1489263-00-4) should be stored in a cool, d...

Compound Q&A

What precautions should be taken when handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

When handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3), safety go...

40716-16-34-Methyl-6-(trifluor...
Compound Q&A

What is 4-(3,5-Difluorophenyl)aniline (CAS: 405058-00-6)?

4-(3,5-Difluorophenyl)aniline is an aromatic organic compound with the CAS numbe...

405058-00-64-(3,5-Difluoropheny...
Compound Q&A

How is 5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid (CAS: 338982-07-3) typically synthesized?

5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid can ...

338982-07-35-{[4-(Trifluorometh...
Compound Q&A

What is the market or research trend for 4-Benzylaniline hydrochloride (CAS: 6317-57-3)?

The market for 4-Benzylaniline hydrochloride (CAS: 6317-57-3) is steadily growin...

6317-57-34-Benzylaniline hydr...