Compound Q&A

What is [3-(Diethylsulfamoyl)phenyl]boronic acid (CAS: 871329-58-7)?

Answer

[3-(Diethylsulfamoyl)phenyl]boronic acid
[3-(Diethylsulfamoyl)phenyl]boronic acid is a chemical compound with the CAS number 871329-58-7. It features a boronic acid moiety attached to a phenyl ring with a diethylsulfamoyl substituent. This compound is characterized by its ability to form stable complexes and has potential applications in various fields including pharmaceuticals and organic synthesis.

About

English Name [3-(Diethylsulfamoyl)phenyl]boronic acid
Molecular Formula C10H16BNO4S
Molecular Weight 257.12 g/mol
SMILES B(C1=CC(=CC=C1)S(=O)(=O)N(CC)CC)(O)O
InChIKey PSMCZVAPCNNYTE-UHFFFAOYSA-N
Last Updated: 2026-03-06 20:15

Related Q&A

Compound Q&A

What are the main uses of [3-(Diethylsulfamoyl)phenyl]boronic acid (CAS: 871329-58-7)?

[3-(Diethylsulfamoyl)phenyl]boronic acid is primarily used as a reagent in organic synthesis, partic...

Compound Q&A

Is [3-(Diethylsulfamoyl)phenyl]boronic acid (CAS: 871329-58-7) safe?

[3-(Diethylsulfamoyl)phenyl]boronic acid is generally considered safe when handled under proper labo...

Compound Q&A

How should [3-(Diethylsulfamoyl)phenyl]boronic acid (CAS: 871329-58-7) be stored?

[3-(Diethylsulfamoyl)phenyl]boronic acid should be stored in a cool, dry place away from direct sunl...

Compound Q&A

What precautions should be taken when handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

When handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3), safety go...

40716-16-34-Methyl-6-(trifluor...
Compound Q&A

What is 4-(3,5-Difluorophenyl)aniline (CAS: 405058-00-6)?

4-(3,5-Difluorophenyl)aniline is an aromatic organic compound with the CAS numbe...

405058-00-64-(3,5-Difluoropheny...
Compound Q&A

How is 5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid (CAS: 338982-07-3) typically synthesized?

5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid can ...

338982-07-35-{[4-(Trifluorometh...
Compound Q&A

What is the market or research trend for 4-Benzylaniline hydrochloride (CAS: 6317-57-3)?

The market for 4-Benzylaniline hydrochloride (CAS: 6317-57-3) is steadily growin...

6317-57-34-Benzylaniline hydr...